C9H9BrClFN2O3S — CID 107212145
1-(3-amino-4-bromo-5-chloro-2-fluorophenyl)sulfonylazetidin-3-ol (PubChem CID 107212145) has the molecular formula C9H9BrClFN2O3S and a molecular weight of 359.60 g/mol. Its IUPAC name is 1-(3-amino-4-bromo-5-chloro-2-fluorophenyl)sulfonylazetidin-3-ol.
| Compound Name | 1-(3-amino-4-bromo-5-chloro-2-fluorophenyl)sulfonylazetidin-3-ol |
|---|---|
| PubChem CID | 107212145 |
| Molecular Formula | C9H9BrClFN2O3S |
| Molecular Weight | 359.60 g/mol |
| Exact Mass | 357.92 |
| IUPAC Name | 1-(3-amino-4-bromo-5-chloro-2-fluorophenyl)sulfonylazetidin-3-ol |
| SMILES | Nc1c(F)c(S(=O)(=O)N2CC(O)C2)cc(Cl)c1Br |
| InChI | InChI=1S/C9H9BrClFN2O3S/c10-7-5(11)1-6(8(12)9(7)13)18(16,17)14-2-4(15)3-14/h1,4,15H,2-3,13H2 |
| InChIKey | DVRBRXISKJEUHT-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.60 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|