C12H15BrClFN2O3S — CID 103077319
2-bromo-3-chloro-5-(2,2-dimethylmorpholin-4-yl)sulfonyl-6-fluoroaniline (PubChem CID 103077319) has the molecular formula C12H15BrClFN2O3S and a molecular weight of 401.69 g/mol. Its IUPAC name is 2-bromo-3-chloro-5-(2,2-dimethylmorpholin-4-yl)sulfonyl-6-fluoroaniline.
| Compound Name | 2-bromo-3-chloro-5-(2,2-dimethylmorpholin-4-yl)sulfonyl-6-fluoroaniline |
|---|---|
| PubChem CID | 103077319 |
| Molecular Formula | C12H15BrClFN2O3S |
| Molecular Weight | 401.69 g/mol |
| Exact Mass | 399.97 |
| IUPAC Name | 2-bromo-3-chloro-5-(2,2-dimethylmorpholin-4-yl)sulfonyl-6-fluoroaniline |
| SMILES | CC1(C)CN(S(=O)(=O)c2cc(Cl)c(Br)c(N)c2F)CCO1 |
| InChI | InChI=1S/C12H15BrClFN2O3S/c1-12(2)6-17(3-4-20-12)21(18,19)8-5-7(14)9(13)11(16)10(8)15/h5H,3-4,6,16H2,1-2H3 |
| InChIKey | JKIBZWQZNPDTTI-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.69 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|