C13H17BrClFN2O2S — CID 103077464
2-bromo-3-chloro-5-(4,4-dimethylpiperidin-1-yl)sulfonyl-6-fluoroaniline (PubChem CID 103077464) has the molecular formula C13H17BrClFN2O2S and a molecular weight of 399.71 g/mol. Its IUPAC name is 2-bromo-3-chloro-5-(4,4-dimethylpiperidin-1-yl)sulfonyl-6-fluoroaniline.
| Compound Name | 2-bromo-3-chloro-5-(4,4-dimethylpiperidin-1-yl)sulfonyl-6-fluoroaniline |
|---|---|
| PubChem CID | 103077464 |
| Molecular Formula | C13H17BrClFN2O2S |
| Molecular Weight | 399.71 g/mol |
| Exact Mass | 397.99 |
| IUPAC Name | 2-bromo-3-chloro-5-(4,4-dimethylpiperidin-1-yl)sulfonyl-6-fluoroaniline |
| SMILES | CC1(C)CCN(S(=O)(=O)c2cc(Cl)c(Br)c(N)c2F)CC1 |
| InChI | InChI=1S/C13H17BrClFN2O2S/c1-13(2)3-5-18(6-4-13)21(19,20)9-7-8(15)10(14)12(17)11(9)16/h7H,3-6,17H2,1-2H3 |
| InChIKey | KEEZMOXHSQIXGI-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.71 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|