C10H10BrClFN3O3S — CID 103077171
4-(3-amino-4-bromo-5-chloro-2-fluorophenyl)sulfonylpiperazin-2-one (PubChem CID 103077171) has the molecular formula C10H10BrClFN3O3S and a molecular weight of 386.63 g/mol. Its IUPAC name is 4-(3-amino-4-bromo-5-chloro-2-fluorophenyl)sulfonylpiperazin-2-one.
| Compound Name | 4-(3-amino-4-bromo-5-chloro-2-fluorophenyl)sulfonylpiperazin-2-one |
|---|---|
| PubChem CID | 103077171 |
| Molecular Formula | C10H10BrClFN3O3S |
| Molecular Weight | 386.63 g/mol |
| Exact Mass | 384.93 |
| IUPAC Name | 4-(3-amino-4-bromo-5-chloro-2-fluorophenyl)sulfonylpiperazin-2-one |
| SMILES | Nc1c(F)c(S(=O)(=O)N2CCNC(=O)C2)cc(Cl)c1Br |
| InChI | InChI=1S/C10H10BrClFN3O3S/c11-8-5(12)3-6(9(13)10(8)14)20(18,19)16-2-1-15-7(17)4-16/h3H,1-2,4,14H2,(H,15,17) |
| InChIKey | VKLPYCILYWGHQV-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.63 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|