C12H15BrClFN2O2S — CID 103077581
2-bromo-3-chloro-5-(3,3-dimethylpyrrolidin-1-yl)sulfonyl-6-fluoroaniline (PubChem CID 103077581) has the molecular formula C12H15BrClFN2O2S and a molecular weight of 385.69 g/mol. Its IUPAC name is 2-bromo-3-chloro-5-(3,3-dimethylpyrrolidin-1-yl)sulfonyl-6-fluoroaniline.
| Compound Name | 2-bromo-3-chloro-5-(3,3-dimethylpyrrolidin-1-yl)sulfonyl-6-fluoroaniline |
|---|---|
| PubChem CID | 103077581 |
| Molecular Formula | C12H15BrClFN2O2S |
| Molecular Weight | 385.69 g/mol |
| Exact Mass | 383.97 |
| IUPAC Name | 2-bromo-3-chloro-5-(3,3-dimethylpyrrolidin-1-yl)sulfonyl-6-fluoroaniline |
| SMILES | CC1(C)CCN(S(=O)(=O)c2cc(Cl)c(Br)c(N)c2F)C1 |
| InChI | InChI=1S/C12H15BrClFN2O2S/c1-12(2)3-4-17(6-12)20(18,19)8-5-7(14)9(13)11(16)10(8)15/h5H,3-4,6,16H2,1-2H3 |
| InChIKey | RFJGFRUYVLRFMT-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.69 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|