C12H15BrClFN2O3S — CID 103077595
1-(3-amino-4-bromo-5-chloro-2-fluorophenyl)sulfonyl-4-methylpiperidin-4-ol (PubChem CID 103077595) has the molecular formula C12H15BrClFN2O3S and a molecular weight of 401.69 g/mol. Its IUPAC name is 1-(3-amino-4-bromo-5-chloro-2-fluorophenyl)sulfonyl-4-methylpiperidin-4-ol.
| Compound Name | 1-(3-amino-4-bromo-5-chloro-2-fluorophenyl)sulfonyl-4-methylpiperidin-4-ol |
|---|---|
| PubChem CID | 103077595 |
| Molecular Formula | C12H15BrClFN2O3S |
| Molecular Weight | 401.69 g/mol |
| Exact Mass | 399.97 |
| IUPAC Name | 1-(3-amino-4-bromo-5-chloro-2-fluorophenyl)sulfonyl-4-methylpiperidin-4-ol |
| SMILES | CC1(O)CCN(S(=O)(=O)c2cc(Cl)c(Br)c(N)c2F)CC1 |
| InChI | InChI=1S/C12H15BrClFN2O3S/c1-12(18)2-4-17(5-3-12)21(19,20)8-6-7(14)9(13)11(16)10(8)15/h6,18H,2-5,16H2,1H3 |
| InChIKey | RNVBROWHPSUNCQ-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.69 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|