C13H18BrFN2O2S — CID 116530376
2-bromo-5-(3,3-dimethylpiperidin-1-yl)sulfonyl-4-fluoroaniline (PubChem CID 116530376) has the molecular formula C13H18BrFN2O2S and a molecular weight of 365.27 g/mol. Its IUPAC name is 2-bromo-5-(3,3-dimethylpiperidin-1-yl)sulfonyl-4-fluoroaniline.
| Compound Name | 2-bromo-5-(3,3-dimethylpiperidin-1-yl)sulfonyl-4-fluoroaniline |
|---|---|
| PubChem CID | 116530376 |
| Molecular Formula | C13H18BrFN2O2S |
| Molecular Weight | 365.27 g/mol |
| Exact Mass | 364.03 |
| IUPAC Name | 2-bromo-5-(3,3-dimethylpiperidin-1-yl)sulfonyl-4-fluoroaniline |
| SMILES | CC1(C)CCCN(S(=O)(=O)c2cc(N)c(Br)cc2F)C1 |
| InChI | InChI=1S/C13H18BrFN2O2S/c1-13(2)4-3-5-17(8-13)20(18,19)12-7-11(16)9(14)6-10(12)15/h6-7H,3-5,8,16H2,1-2H3 |
| InChIKey | LYVXUIAYPWSMNI-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.27 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|