C14H20N2O4S — CID 81457932
3-amino-4-(3,3-dimethylpiperidin-1-yl)sulfonylbenzoic acid (PubChem CID 81457932) has the molecular formula C14H20N2O4S and a molecular weight of 312.39 g/mol. Its IUPAC name is 3-amino-4-(3,3-dimethylpiperidin-1-yl)sulfonylbenzoic acid.
| Compound Name | 3-amino-4-(3,3-dimethylpiperidin-1-yl)sulfonylbenzoic acid |
|---|---|
| PubChem CID | 81457932 |
| Molecular Formula | C14H20N2O4S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | 3-amino-4-(3,3-dimethylpiperidin-1-yl)sulfonylbenzoic acid |
| SMILES | CC1(C)CCCN(S(=O)(=O)c2ccc(C(=O)O)cc2N)C1 |
| InChI | InChI=1S/C14H20N2O4S/c1-14(2)6-3-7-16(9-14)21(19,20)12-5-4-10(13(17)18)8-11(12)15/h4-5,8H,3,6-7,9,15H2,1-2H3,(H,17,18) |
| InChIKey | PQHZPAWGQUSNMM-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 100.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|