C12H18ClN3O2S — CID 64601329
3-chloro-5-(3,3-dimethylpiperidin-1-yl)sulfonylpyridin-2-amine (PubChem CID 64601329) has the molecular formula C12H18ClN3O2S and a molecular weight of 303.81 g/mol. Its IUPAC name is 3-chloro-5-(3,3-dimethylpiperidin-1-yl)sulfonylpyridin-2-amine.
| Compound Name | 3-chloro-5-(3,3-dimethylpiperidin-1-yl)sulfonylpyridin-2-amine |
|---|---|
| PubChem CID | 64601329 |
| Molecular Formula | C12H18ClN3O2S |
| Molecular Weight | 303.81 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | 3-chloro-5-(3,3-dimethylpiperidin-1-yl)sulfonylpyridin-2-amine |
| SMILES | CC1(C)CCCN(S(=O)(=O)c2cnc(N)c(Cl)c2)C1 |
| InChI | InChI=1S/C12H18ClN3O2S/c1-12(2)4-3-5-16(8-12)19(17,18)9-6-10(13)11(14)15-7-9/h6-7H,3-5,8H2,1-2H3,(H2,14,15) |
| InChIKey | UOHRXAFPFRCYDV-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.81 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |