C12H19ClN4O3S — CID 107393383
[3-chloro-5-(3-methoxy-3-methylpiperidin-1-yl)sulfonyl-2-pyridinyl]hydrazine (PubChem CID 107393383) has the molecular formula C12H19ClN4O3S and a molecular weight of 334.83 g/mol. Its IUPAC name is [3-chloro-5-(3-methoxy-3-methylpiperidin-1-yl)sulfonyl-2-pyridinyl]hydrazine.
| Compound Name | [3-chloro-5-(3-methoxy-3-methylpiperidin-1-yl)sulfonyl-2-pyridinyl]hydrazine |
|---|---|
| PubChem CID | 107393383 |
| Molecular Formula | C12H19ClN4O3S |
| Molecular Weight | 334.83 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | [3-chloro-5-(3-methoxy-3-methylpiperidin-1-yl)sulfonyl-2-pyridinyl]hydrazine |
| SMILES | COC1(C)CCCN(S(=O)(=O)c2cnc(NN)c(Cl)c2)C1 |
| InChI | InChI=1S/C12H19ClN4O3S/c1-12(20-2)4-3-5-17(8-12)21(18,19)9-6-10(13)11(16-14)15-7-9/h6-7H,3-5,8,14H2,1-2H3,(H,15,16) |
| InChIKey | ZLGSKFVLLCYPIO-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 97.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.83 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|