About methyl 5-(3-methoxy-3-methylpiperidin-1-yl)sulfonyl-1,3-thiazole-4-carboxylate
methyl 5-(3-methoxy-3-methylpiperidin-1-yl)sulfonyl-1,3-thiazole-4-carboxylate (PubChem CID 107390968) has the molecular formula C12H18N2O5S2
and a molecular weight of 334.42 g/mol. Its IUPAC name is methyl 5-(3-methoxy-3-methylpiperidin-1-yl)sulfonyl-1,3-thiazole-4-carboxylate.
Molecular Properties
| Compound Name | methyl 5-(3-methoxy-3-methylpiperidin-1-yl)sulfonyl-1,3-thiazole-4-carboxylate |
| PubChem CID | 107390968 |
| Molecular Formula | C12H18N2O5S2 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | methyl 5-(3-methoxy-3-methylpiperidin-1-yl)sulfonyl-1,3-thiazole-4-carboxylate |
| SMILES | COC(=O)c1ncsc1S(=O)(=O)N1CCCC(C)(OC)C1 |
| InChI | InChI=1S/C12H18N2O5S2/c1-12(19-3)5-4-6-14(7-12)21(16,17)11-9(10(15)18-2)13-8-20-11/h8H,4-7H2,1-3H3 |
| InChIKey | WICFOIDGHBFZPC-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 85.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze methyl 5-(3-methoxy-3-methylpiperidin-1-yl)sulfonyl-1,3-thiazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-(3-methoxy-3-methylpiperidin-1-yl)sulfonyl-1,3-thiazole-4-carboxylate?
The IUPAC name of methyl 5-(3-methoxy-3-methylpiperidin-1-yl)sulfonyl-1,3-thiazole-4-carboxylate (CID 107390968) is methyl 5-(3-methoxy-3-methylpiperidin-1-yl)sulfonyl-1,3-thiazole-4-carboxylate.
What is the SMILES notation for methyl 5-(3-methoxy-3-methylpiperidin-1-yl)sulfonyl-1,3-thiazole-4-carboxylate?
The canonical SMILES for methyl 5-(3-methoxy-3-methylpiperidin-1-yl)sulfonyl-1,3-thiazole-4-carboxylate is COC(=O)c1ncsc1S(=O)(=O)N1CCCC(C)(OC)C1.
What is the InChIKey of methyl 5-(3-methoxy-3-methylpiperidin-1-yl)sulfonyl-1,3-thiazole-4-carboxylate?
The InChIKey is WICFOIDGHBFZPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N2O5S2/c1-12(19-3)5-4-6-14(7-12)21(16,17)11-9(10(15)18-2)13-8-20-11/h8H,4-7H2,1-3H3.
What are the key properties of methyl 5-(3-methoxy-3-methylpiperidin-1-yl)sulfonyl-1,3-thiazole-4-carboxylate?
methyl 5-(3-methoxy-3-methylpiperidin-1-yl)sulfonyl-1,3-thiazole-4-carboxylate has a molecular weight of 334.42 g/mol, XLogP of 1.12, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-(3-methoxy-3-methylpiperidin-1-yl)sulfonyl-1,3-thiazole-4-carboxylate is sourced from PubChem (CID 107390968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).