C12H19NO4S2 — CID 107396073
[4-(3-methoxy-3-methylpiperidin-1-yl)sulfonylthiophen-2-yl]methanol (PubChem CID 107396073) has the molecular formula C12H19NO4S2 and a molecular weight of 305.42 g/mol. Its IUPAC name is [4-(3-methoxy-3-methylpiperidin-1-yl)sulfonylthiophen-2-yl]methanol.
| Compound Name | [4-(3-methoxy-3-methylpiperidin-1-yl)sulfonylthiophen-2-yl]methanol |
|---|---|
| PubChem CID | 107396073 |
| Molecular Formula | C12H19NO4S2 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | [4-(3-methoxy-3-methylpiperidin-1-yl)sulfonylthiophen-2-yl]methanol |
| SMILES | COC1(C)CCCN(S(=O)(=O)c2csc(CO)c2)C1 |
| InChI | InChI=1S/C12H19NO4S2/c1-12(17-2)4-3-5-13(9-12)19(15,16)11-6-10(7-14)18-8-11/h6,8,14H,3-5,7,9H2,1-2H3 |
| InChIKey | XUCXOKWJPPPKEK-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |