C13H21BrN2O4S — CID 107396218
1-[5-bromo-4-(3-methoxy-3-methylpiperidin-1-yl)sulfonylfuran-2-yl]-N-methylmethanamine (PubChem CID 107396218) has the molecular formula C13H21BrN2O4S and a molecular weight of 381.29 g/mol. Its IUPAC name is 1-[5-bromo-4-(3-methoxy-3-methylpiperidin-1-yl)sulfonylfuran-2-yl]-N-methylmethanamine.
| Compound Name | 1-[5-bromo-4-(3-methoxy-3-methylpiperidin-1-yl)sulfonylfuran-2-yl]-N-methylmethanamine |
|---|---|
| PubChem CID | 107396218 |
| Molecular Formula | C13H21BrN2O4S |
| Molecular Weight | 381.29 g/mol |
| Exact Mass | 380.04 |
| IUPAC Name | 1-[5-bromo-4-(3-methoxy-3-methylpiperidin-1-yl)sulfonylfuran-2-yl]-N-methylmethanamine |
| SMILES | CNCc1cc(S(=O)(=O)N2CCCC(C)(OC)C2)c(Br)o1 |
| InChI | InChI=1S/C13H21BrN2O4S/c1-13(19-3)5-4-6-16(9-13)21(17,18)11-7-10(8-15-2)20-12(11)14/h7,15H,4-6,8-9H2,1-3H3 |
| InChIKey | NHJZDKUJQRJWDH-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.29 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |