C11H18BrN3O3S — CID 106075338
2-bromo-5-(methylaminomethyl)-N-piperidin-1-ylfuran-3-sulfonamide (PubChem CID 106075338) has the molecular formula C11H18BrN3O3S and a molecular weight of 352.25 g/mol. Its IUPAC name is 2-bromo-5-(methylaminomethyl)-N-piperidin-1-ylfuran-3-sulfonamide.
| Compound Name | 2-bromo-5-(methylaminomethyl)-N-piperidin-1-ylfuran-3-sulfonamide |
|---|---|
| PubChem CID | 106075338 |
| Molecular Formula | C11H18BrN3O3S |
| Molecular Weight | 352.25 g/mol |
| Exact Mass | 351.03 |
| IUPAC Name | 2-bromo-5-(methylaminomethyl)-N-piperidin-1-ylfuran-3-sulfonamide |
| SMILES | CNCc1cc(S(=O)(=O)NN2CCCCC2)c(Br)o1 |
| InChI | InChI=1S/C11H18BrN3O3S/c1-13-8-9-7-10(11(12)18-9)19(16,17)14-15-5-3-2-4-6-15/h7,13-14H,2-6,8H2,1H3 |
| InChIKey | WXWYQRZAEGFQSF-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.25 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |