C13H14BrClN2O3S — CID 106023358
2-bromo-N-[(4-chlorophenyl)methyl]-5-(methylaminomethyl)furan-3-sulfonamide (PubChem CID 106023358) has the molecular formula C13H14BrClN2O3S and a molecular weight of 393.69 g/mol. Its IUPAC name is 2-bromo-N-[(4-chlorophenyl)methyl]-5-(methylaminomethyl)furan-3-sulfonamide.
| Compound Name | 2-bromo-N-[(4-chlorophenyl)methyl]-5-(methylaminomethyl)furan-3-sulfonamide |
|---|---|
| PubChem CID | 106023358 |
| Molecular Formula | C13H14BrClN2O3S |
| Molecular Weight | 393.69 g/mol |
| Exact Mass | 391.96 |
| IUPAC Name | 2-bromo-N-[(4-chlorophenyl)methyl]-5-(methylaminomethyl)furan-3-sulfonamide |
| SMILES | CNCc1cc(S(=O)(=O)NCc2ccc(Cl)cc2)c(Br)o1 |
| InChI | InChI=1S/C13H14BrClN2O3S/c1-16-8-11-6-12(13(14)20-11)21(18,19)17-7-9-2-4-10(15)5-3-9/h2-6,16-17H,7-8H2,1H3 |
| InChIKey | ZTRPJUXJCMXWHL-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.69 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |