C11H13BrN4O3S — CID 106089523
2-bromo-5-(methylaminomethyl)-N-(pyridazin-3-ylmethyl)furan-3-sulfonamide (PubChem CID 106089523) has the molecular formula C11H13BrN4O3S and a molecular weight of 361.22 g/mol. Its IUPAC name is 2-bromo-5-(methylaminomethyl)-N-(pyridazin-3-ylmethyl)furan-3-sulfonamide.
| Compound Name | 2-bromo-5-(methylaminomethyl)-N-(pyridazin-3-ylmethyl)furan-3-sulfonamide |
|---|---|
| PubChem CID | 106089523 |
| Molecular Formula | C11H13BrN4O3S |
| Molecular Weight | 361.22 g/mol |
| Exact Mass | 359.99 |
| IUPAC Name | 2-bromo-5-(methylaminomethyl)-N-(pyridazin-3-ylmethyl)furan-3-sulfonamide |
| SMILES | CNCc1cc(S(=O)(=O)NCc2cccnn2)c(Br)o1 |
| InChI | InChI=1S/C11H13BrN4O3S/c1-13-7-9-5-10(11(12)19-9)20(17,18)15-6-8-3-2-4-14-16-8/h2-5,13,15H,6-7H2,1H3 |
| InChIKey | WNAPKZSJPBQGGH-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 97.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.22 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |