C13H16N4O2S — CID 106894665
2-amino-4,5-dimethyl-N-(pyridazin-3-ylmethyl)benzenesulfonamide (PubChem CID 106894665) has the molecular formula C13H16N4O2S and a molecular weight of 292.36 g/mol. Its IUPAC name is 2-amino-4,5-dimethyl-N-(pyridazin-3-ylmethyl)benzenesulfonamide.
| Compound Name | 2-amino-4,5-dimethyl-N-(pyridazin-3-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 106894665 |
| Molecular Formula | C13H16N4O2S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 2-amino-4,5-dimethyl-N-(pyridazin-3-ylmethyl)benzenesulfonamide |
| SMILES | Cc1cc(N)c(S(=O)(=O)NCc2cccnn2)cc1C |
| InChI | InChI=1S/C13H16N4O2S/c1-9-6-12(14)13(7-10(9)2)20(18,19)16-8-11-4-3-5-15-17-11/h3-7,16H,8,14H2,1-2H3 |
| InChIKey | LITGKMXQHZRVFM-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|