C12H15N3O3S — CID 81169956
2-amino-4,5-dimethyl-N-(1,2-oxazol-3-ylmethyl)benzenesulfonamide (PubChem CID 81169956) has the molecular formula C12H15N3O3S and a molecular weight of 281.34 g/mol. Its IUPAC name is 2-amino-4,5-dimethyl-N-(1,2-oxazol-3-ylmethyl)benzenesulfonamide.
| Compound Name | 2-amino-4,5-dimethyl-N-(1,2-oxazol-3-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 81169956 |
| Molecular Formula | C12H15N3O3S |
| Molecular Weight | 281.34 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | 2-amino-4,5-dimethyl-N-(1,2-oxazol-3-ylmethyl)benzenesulfonamide |
| SMILES | Cc1cc(N)c(S(=O)(=O)NCc2ccon2)cc1C |
| InChI | InChI=1S/C12H15N3O3S/c1-8-5-11(13)12(6-9(8)2)19(16,17)14-7-10-3-4-18-15-10/h3-6,14H,7,13H2,1-2H3 |
| InChIKey | OESPRVNLUSXMNR-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 98.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.34 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|