C10H10BrN3O3S — CID 81171163
2-amino-5-bromo-N-(1,2-oxazol-3-ylmethyl)benzenesulfonamide (PubChem CID 81171163) has the molecular formula C10H10BrN3O3S and a molecular weight of 332.18 g/mol. Its IUPAC name is 2-amino-5-bromo-N-(1,2-oxazol-3-ylmethyl)benzenesulfonamide.
| Compound Name | 2-amino-5-bromo-N-(1,2-oxazol-3-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 81171163 |
| Molecular Formula | C10H10BrN3O3S |
| Molecular Weight | 332.18 g/mol |
| Exact Mass | 330.96 |
| IUPAC Name | 2-amino-5-bromo-N-(1,2-oxazol-3-ylmethyl)benzenesulfonamide |
| SMILES | Nc1ccc(Br)cc1S(=O)(=O)NCc1ccon1 |
| InChI | InChI=1S/C10H10BrN3O3S/c11-7-1-2-9(12)10(5-7)18(15,16)13-6-8-3-4-17-14-8/h1-5,13H,6,12H2 |
| InChIKey | BKRREYMDYVVVDJ-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 98.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.18 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|