C11H8BrFN2O5S — CID 81176900
5-bromo-2-fluoro-3-(1,2-oxazol-3-ylmethylsulfamoyl)benzoic acid (PubChem CID 81176900) has the molecular formula C11H8BrFN2O5S and a molecular weight of 379.16 g/mol. Its IUPAC name is 5-bromo-2-fluoro-3-(1,2-oxazol-3-ylmethylsulfamoyl)benzoic acid.
| Compound Name | 5-bromo-2-fluoro-3-(1,2-oxazol-3-ylmethylsulfamoyl)benzoic acid |
|---|---|
| PubChem CID | 81176900 |
| Molecular Formula | C11H8BrFN2O5S |
| Molecular Weight | 379.16 g/mol |
| Exact Mass | 377.93 |
| IUPAC Name | 5-bromo-2-fluoro-3-(1,2-oxazol-3-ylmethylsulfamoyl)benzoic acid |
| SMILES | O=C(O)c1cc(Br)cc(S(=O)(=O)NCc2ccon2)c1F |
| InChI | InChI=1S/C11H8BrFN2O5S/c12-6-3-8(11(16)17)10(13)9(4-6)21(18,19)14-5-7-1-2-20-15-7/h1-4,14H,5H2,(H,16,17) |
| InChIKey | OROVMUBYFBGJJJ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 109.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.16 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |