C11H8BrFN2O5S — CID 43323944
5-bromo-2-fluoro-3-[(5-methyl-1,2-oxazol-3-yl)sulfamoyl]benzoic acid (PubChem CID 43323944) has the molecular formula C11H8BrFN2O5S and a molecular weight of 379.16 g/mol. Its IUPAC name is 5-bromo-2-fluoro-3-[(5-methyl-1,2-oxazol-3-yl)sulfamoyl]benzoic acid.
| Compound Name | 5-bromo-2-fluoro-3-[(5-methyl-1,2-oxazol-3-yl)sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 43323944 |
| Molecular Formula | C11H8BrFN2O5S |
| Molecular Weight | 379.16 g/mol |
| Exact Mass | 377.93 |
| IUPAC Name | 5-bromo-2-fluoro-3-[(5-methyl-1,2-oxazol-3-yl)sulfamoyl]benzoic acid |
| SMILES | Cc1cc(NS(=O)(=O)c2cc(Br)cc(C(=O)O)c2F)no1 |
| InChI | InChI=1S/C11H8BrFN2O5S/c1-5-2-9(14-20-5)15-21(18,19)8-4-6(12)3-7(10(8)13)11(16)17/h2-4H,1H3,(H,14,15)(H,16,17) |
| InChIKey | AGKZKJIKIGSXAI-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 109.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.16 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |