C10H6BrFN2O4S2 — CID 43323216
5-bromo-2-fluoro-3-(1,3-thiazol-2-ylsulfamoyl)benzoic acid (PubChem CID 43323216) has the molecular formula C10H6BrFN2O4S2 and a molecular weight of 381.20 g/mol. Its IUPAC name is 5-bromo-2-fluoro-3-(1,3-thiazol-2-ylsulfamoyl)benzoic acid.
| Compound Name | 5-bromo-2-fluoro-3-(1,3-thiazol-2-ylsulfamoyl)benzoic acid |
|---|---|
| PubChem CID | 43323216 |
| Molecular Formula | C10H6BrFN2O4S2 |
| Molecular Weight | 381.20 g/mol |
| Exact Mass | 379.89 |
| IUPAC Name | 5-bromo-2-fluoro-3-(1,3-thiazol-2-ylsulfamoyl)benzoic acid |
| SMILES | O=C(O)c1cc(Br)cc(S(=O)(=O)Nc2nccs2)c1F |
| InChI | InChI=1S/C10H6BrFN2O4S2/c11-5-3-6(9(15)16)8(12)7(4-5)20(17,18)14-10-13-1-2-19-10/h1-4H,(H,13,14)(H,15,16) |
| InChIKey | HZDJJUBHIMLSDJ-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.20 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |