C9H8BrN3O2S2 — CID 43256872
2-amino-4-bromo-N-(1,3-thiazol-2-yl)benzenesulfonamide (PubChem CID 43256872) has the molecular formula C9H8BrN3O2S2 and a molecular weight of 334.22 g/mol. Its IUPAC name is 2-amino-4-bromo-N-(1,3-thiazol-2-yl)benzenesulfonamide.
| Compound Name | 2-amino-4-bromo-N-(1,3-thiazol-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 43256872 |
| Molecular Formula | C9H8BrN3O2S2 |
| Molecular Weight | 334.22 g/mol |
| Exact Mass | 332.92 |
| IUPAC Name | 2-amino-4-bromo-N-(1,3-thiazol-2-yl)benzenesulfonamide |
| SMILES | Nc1cc(Br)ccc1S(=O)(=O)Nc1nccs1 |
| InChI | InChI=1S/C9H8BrN3O2S2/c10-6-1-2-8(7(11)5-6)17(14,15)13-9-12-3-4-16-9/h1-5H,11H2,(H,12,13) |
| InChIKey | OCHICNJCZJWYIF-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.22 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|