C10H9N3O3S2 — CID 87483084
2-(1,3-thiazol-2-ylsulfamoyl)benzamide (PubChem CID 87483084) has the molecular formula C10H9N3O3S2 and a molecular weight of 283.33 g/mol. Its IUPAC name is 2-(1,3-thiazol-2-ylsulfamoyl)benzamide.
| Compound Name | 2-(1,3-thiazol-2-ylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 87483084 |
| Molecular Formula | C10H9N3O3S2 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.01 |
| IUPAC Name | 2-(1,3-thiazol-2-ylsulfamoyl)benzamide |
| SMILES | NC(=O)c1ccccc1S(=O)(=O)Nc1nccs1 |
| InChI | InChI=1S/C10H9N3O3S2/c11-9(14)7-3-1-2-4-8(7)18(15,16)13-10-12-5-6-17-10/h1-6H,(H2,11,14)(H,12,13) |
| InChIKey | HUULMKSDPTYFFY-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |