About 2-[[2,6-di(propan-2-yl)phenyl]sulfamoyl]benzamide
2-[[2,6-di(propan-2-yl)phenyl]sulfamoyl]benzamide (PubChem CID 142667190) has the molecular formula C19H24N2O3S
and a molecular weight of 360.48 g/mol. Its IUPAC name is 2-[[2,6-di(propan-2-yl)phenyl]sulfamoyl]benzamide.
Molecular Properties
| Compound Name | 2-[[2,6-di(propan-2-yl)phenyl]sulfamoyl]benzamide |
| PubChem CID | 142667190 |
| Molecular Formula | C19H24N2O3S |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | 2-[[2,6-di(propan-2-yl)phenyl]sulfamoyl]benzamide |
| SMILES | CC(C)c1cccc(C(C)C)c1NS(=O)(=O)c1ccccc1C(N)=O |
| InChI | InChI=1S/C19H24N2O3S/c1-12(2)14-9-7-10-15(13(3)4)18(14)21-25(23,24)17-11-6-5-8-16(17)19(20)22/h5-13,21H,1-4H3,(H2,20,22) |
| InChIKey | NBIVJDBOALKONY-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[[2,6-di(propan-2-yl)phenyl]sulfamoyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[2,6-di(propan-2-yl)phenyl]sulfamoyl]benzamide?
The IUPAC name of 2-[[2,6-di(propan-2-yl)phenyl]sulfamoyl]benzamide (CID 142667190) is 2-[[2,6-di(propan-2-yl)phenyl]sulfamoyl]benzamide.
What is the SMILES notation for 2-[[2,6-di(propan-2-yl)phenyl]sulfamoyl]benzamide?
The canonical SMILES for 2-[[2,6-di(propan-2-yl)phenyl]sulfamoyl]benzamide is CC(C)c1cccc(C(C)C)c1NS(=O)(=O)c1ccccc1C(N)=O.
What is the InChIKey of 2-[[2,6-di(propan-2-yl)phenyl]sulfamoyl]benzamide?
The InChIKey is NBIVJDBOALKONY-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H24N2O3S/c1-12(2)14-9-7-10-15(13(3)4)18(14)21-25(23,24)17-11-6-5-8-16(17)19(20)22/h5-13,21H,1-4H3,(H2,20,22).
What are the key properties of 2-[[2,6-di(propan-2-yl)phenyl]sulfamoyl]benzamide?
2-[[2,6-di(propan-2-yl)phenyl]sulfamoyl]benzamide has a molecular weight of 360.48 g/mol, XLogP of 3.83, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[2,6-di(propan-2-yl)phenyl]sulfamoyl]benzamide is sourced from PubChem (CID 142667190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).