C21H24N2O2S — CID 19683991
N-[2,6-di(propan-2-yl)phenyl]quinoline-8-sulfonamide (PubChem CID 19683991) has the molecular formula C21H24N2O2S and a molecular weight of 368.50 g/mol. Its IUPAC name is N-[2,6-di(propan-2-yl)phenyl]quinoline-8-sulfonamide.
| Compound Name | N-[2,6-di(propan-2-yl)phenyl]quinoline-8-sulfonamide |
|---|---|
| PubChem CID | 19683991 |
| Molecular Formula | C21H24N2O2S |
| Molecular Weight | 368.50 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | N-[2,6-di(propan-2-yl)phenyl]quinoline-8-sulfonamide |
| SMILES | CC(C)c1cccc(C(C)C)c1NS(=O)(=O)c1cccc2cccnc12 |
| InChI | InChI=1S/C21H24N2O2S/c1-14(2)17-10-6-11-18(15(3)4)21(17)23-26(24,25)19-12-5-8-16-9-7-13-22-20(16)19/h5-15,23H,1-4H3 |
| InChIKey | KBCHPYBCOGADOI-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.50 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |