C15H10Cl2N2O2S — CID 5068800
N-(2,6-dichlorophenyl)quinoline-8-sulfonamide (PubChem CID 5068800) has the molecular formula C15H10Cl2N2O2S and a molecular weight of 353.23 g/mol. Its IUPAC name is N-(2,6-dichlorophenyl)quinoline-8-sulfonamide.
| Compound Name | N-(2,6-dichlorophenyl)quinoline-8-sulfonamide |
|---|---|
| PubChem CID | 5068800 |
| Molecular Formula | C15H10Cl2N2O2S |
| Molecular Weight | 353.23 g/mol |
| Exact Mass | 351.98 |
| IUPAC Name | N-(2,6-dichlorophenyl)quinoline-8-sulfonamide |
| SMILES | O=S(=O)(Nc1c(Cl)cccc1Cl)c1cccc2cccnc12 |
| InChI | InChI=1S/C15H10Cl2N2O2S/c16-11-6-2-7-12(17)15(11)19-22(20,21)13-8-1-4-10-5-3-9-18-14(10)13/h1-9,19H |
| InChIKey | VJBWEWZPPJYDQR-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.23 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |