C17H16N2O2S — CID 4067742
N-(2,4-dimethylphenyl)quinoline-8-sulfonamide (PubChem CID 4067742) has the molecular formula C17H16N2O2S and a molecular weight of 312.39 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)quinoline-8-sulfonamide.
| Compound Name | N-(2,4-dimethylphenyl)quinoline-8-sulfonamide |
|---|---|
| PubChem CID | 4067742 |
| Molecular Formula | C17H16N2O2S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | N-(2,4-dimethylphenyl)quinoline-8-sulfonamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2cccc3cccnc23)c(C)c1 |
| InChI | InChI=1S/C17H16N2O2S/c1-12-8-9-15(13(2)11-12)19-22(20,21)16-7-3-5-14-6-4-10-18-17(14)16/h3-11,19H,1-2H3 |
| InChIKey | JCBAQJCOHDMOEV-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |