C11H7Cl3N2O2S — CID 60721815
2-chloro-N-(2,6-dichlorophenyl)pyridine-3-sulfonamide (PubChem CID 60721815) has the molecular formula C11H7Cl3N2O2S and a molecular weight of 337.62 g/mol. Its IUPAC name is 2-chloro-N-(2,6-dichlorophenyl)pyridine-3-sulfonamide.
| Compound Name | 2-chloro-N-(2,6-dichlorophenyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 60721815 |
| Molecular Formula | C11H7Cl3N2O2S |
| Molecular Weight | 337.62 g/mol |
| Exact Mass | 335.93 |
| IUPAC Name | 2-chloro-N-(2,6-dichlorophenyl)pyridine-3-sulfonamide |
| SMILES | O=S(=O)(Nc1c(Cl)cccc1Cl)c1cccnc1Cl |
| InChI | InChI=1S/C11H7Cl3N2O2S/c12-7-3-1-4-8(13)10(7)16-19(17,18)9-5-2-6-15-11(9)14/h1-6,16H |
| InChIKey | WRXAPSWNYPFKQM-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.62 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|