C10H6Cl3N3O2S — CID 59168167
2,3-dichloro-N-(3-chloropyrazin-2-yl)benzenesulfonamide (PubChem CID 59168167) has the molecular formula C10H6Cl3N3O2S and a molecular weight of 338.60 g/mol. Its IUPAC name is 2,3-dichloro-N-(3-chloropyrazin-2-yl)benzenesulfonamide.
| Compound Name | 2,3-dichloro-N-(3-chloropyrazin-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 59168167 |
| Molecular Formula | C10H6Cl3N3O2S |
| Molecular Weight | 338.60 g/mol |
| Exact Mass | 336.92 |
| IUPAC Name | 2,3-dichloro-N-(3-chloropyrazin-2-yl)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1nccnc1Cl)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C10H6Cl3N3O2S/c11-6-2-1-3-7(8(6)12)19(17,18)16-10-9(13)14-4-5-15-10/h1-5H,(H,15,16) |
| InChIKey | XZIBJHQAYGYSAW-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.60 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |