C13H12Cl2N2O4S — CID 24621377
2-chloro-N-(4-chloro-2,5-dimethoxyphenyl)pyridine-3-sulfonamide (PubChem CID 24621377) has the molecular formula C13H12Cl2N2O4S and a molecular weight of 363.22 g/mol. Its IUPAC name is 2-chloro-N-(4-chloro-2,5-dimethoxyphenyl)pyridine-3-sulfonamide.
| Compound Name | 2-chloro-N-(4-chloro-2,5-dimethoxyphenyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 24621377 |
| Molecular Formula | C13H12Cl2N2O4S |
| Molecular Weight | 363.22 g/mol |
| Exact Mass | 361.99 |
| IUPAC Name | 2-chloro-N-(4-chloro-2,5-dimethoxyphenyl)pyridine-3-sulfonamide |
| SMILES | COc1cc(NS(=O)(=O)c2cccnc2Cl)c(OC)cc1Cl |
| InChI | InChI=1S/C13H12Cl2N2O4S/c1-20-10-7-9(11(21-2)6-8(10)14)17-22(18,19)12-4-3-5-16-13(12)15/h3-7,17H,1-2H3 |
| InChIKey | QXQPVUFKNOJSAV-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.22 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|