C14H14ClNO4S — CID 710996
N-(4-chloro-2,5-dimethoxyphenyl)benzenesulfonamide (PubChem CID 710996) has the molecular formula C14H14ClNO4S and a molecular weight of 327.79 g/mol. Its IUPAC name is N-(4-chloro-2,5-dimethoxyphenyl)benzenesulfonamide.
| Compound Name | N-(4-chloro-2,5-dimethoxyphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 710996 |
| Molecular Formula | C14H14ClNO4S |
| Molecular Weight | 327.79 g/mol |
| Exact Mass | 327.03 |
| IUPAC Name | N-(4-chloro-2,5-dimethoxyphenyl)benzenesulfonamide |
| SMILES | COc1cc(NS(=O)(=O)c2ccccc2)c(OC)cc1Cl |
| InChI | InChI=1S/C14H14ClNO4S/c1-19-13-9-12(14(20-2)8-11(13)15)16-21(17,18)10-6-4-3-5-7-10/h3-9,16H,1-2H3 |
| InChIKey | DLBRNLJHRWXVHR-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.79 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |