C18H22ClNO4S — CID 22774048
4-butyl-N-(4-chloro-2,5-dimethoxyphenyl)benzenesulfonamide (PubChem CID 22774048) has the molecular formula C18H22ClNO4S and a molecular weight of 383.90 g/mol. Its IUPAC name is 4-butyl-N-(4-chloro-2,5-dimethoxyphenyl)benzenesulfonamide.
| Compound Name | 4-butyl-N-(4-chloro-2,5-dimethoxyphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 22774048 |
| Molecular Formula | C18H22ClNO4S |
| Molecular Weight | 383.90 g/mol |
| Exact Mass | 383.10 |
| IUPAC Name | 4-butyl-N-(4-chloro-2,5-dimethoxyphenyl)benzenesulfonamide |
| SMILES | CCCCc1ccc(S(=O)(=O)Nc2cc(OC)c(Cl)cc2OC)cc1 |
| InChI | InChI=1S/C18H22ClNO4S/c1-4-5-6-13-7-9-14(10-8-13)25(21,22)20-16-12-17(23-2)15(19)11-18(16)24-3/h7-12,20H,4-6H2,1-3H3 |
| InChIKey | YEDVTMCXSAURKN-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.90 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |