C16H19ClN2O4S — CID 167884327
N-(5-chloro-2,4-dimethoxyphenyl)-4-(dimethylamino)benzenesulfonamide (PubChem CID 167884327) has the molecular formula C16H19ClN2O4S and a molecular weight of 370.86 g/mol. Its IUPAC name is N-(5-chloro-2,4-dimethoxyphenyl)-4-(dimethylamino)benzenesulfonamide.
| Compound Name | N-(5-chloro-2,4-dimethoxyphenyl)-4-(dimethylamino)benzenesulfonamide |
|---|---|
| PubChem CID | 167884327 |
| Molecular Formula | C16H19ClN2O4S |
| Molecular Weight | 370.86 g/mol |
| Exact Mass | 370.08 |
| IUPAC Name | N-(5-chloro-2,4-dimethoxyphenyl)-4-(dimethylamino)benzenesulfonamide |
| SMILES | COc1cc(OC)c(NS(=O)(=O)c2ccc(N(C)C)cc2)cc1Cl |
| InChI | InChI=1S/C16H19ClN2O4S/c1-19(2)11-5-7-12(8-6-11)24(20,21)18-14-9-13(17)15(22-3)10-16(14)23-4/h5-10,18H,1-4H3 |
| InChIKey | MWBULQZWPSWERM-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.86 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |