C10H15ClN2O4S — CID 35767285
1-chloro-5-(dimethylsulfamoylamino)-2,4-dimethoxybenzene (PubChem CID 35767285) has the molecular formula C10H15ClN2O4S and a molecular weight of 294.76 g/mol. Its IUPAC name is 1-chloro-5-(dimethylsulfamoylamino)-2,4-dimethoxybenzene.
| Compound Name | 1-chloro-5-(dimethylsulfamoylamino)-2,4-dimethoxybenzene |
|---|---|
| PubChem CID | 35767285 |
| Molecular Formula | C10H15ClN2O4S |
| Molecular Weight | 294.76 g/mol |
| Exact Mass | 294.04 |
| IUPAC Name | 1-chloro-5-(dimethylsulfamoylamino)-2,4-dimethoxybenzene |
| SMILES | COc1cc(OC)c(NS(=O)(=O)N(C)C)cc1Cl |
| InChI | InChI=1S/C10H15ClN2O4S/c1-13(2)18(14,15)12-8-5-7(11)9(16-3)6-10(8)17-4/h5-6,12H,1-4H3 |
| InChIKey | RUSAWMRBBPVWJD-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.76 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |