C9H12ClNO2 — CID 28576065
5-chloro-2,4-dimethoxy-N-methylaniline (PubChem CID 28576065) has the molecular formula C9H12ClNO2 and a molecular weight of 201.65 g/mol. Its IUPAC name is 5-chloro-2,4-dimethoxy-N-methylaniline.
| Compound Name | 5-chloro-2,4-dimethoxy-N-methylaniline |
|---|---|
| PubChem CID | 28576065 |
| Molecular Formula | C9H12ClNO2 |
| Molecular Weight | 201.65 g/mol |
| Exact Mass | 201.06 |
| IUPAC Name | 5-chloro-2,4-dimethoxy-N-methylaniline |
| SMILES | CNc1cc(Cl)c(OC)cc1OC |
| InChI | InChI=1S/C9H12ClNO2/c1-11-7-4-6(10)8(12-2)5-9(7)13-3/h4-5,11H,1-3H3 |
| InChIKey | YCHOITKUKXCTLI-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.65 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|