C10H11ClN2O2 — CID 28572786
2-(4-chloro-2,5-dimethoxyanilino)acetonitrile (PubChem CID 28572786) has the molecular formula C10H11ClN2O2 and a molecular weight of 226.66 g/mol. Its IUPAC name is 2-(4-chloro-2,5-dimethoxyanilino)acetonitrile.
| Compound Name | 2-(4-chloro-2,5-dimethoxyanilino)acetonitrile |
|---|---|
| PubChem CID | 28572786 |
| Molecular Formula | C10H11ClN2O2 |
| Molecular Weight | 226.66 g/mol |
| Exact Mass | 226.05 |
| IUPAC Name | 2-(4-chloro-2,5-dimethoxyanilino)acetonitrile |
| SMILES | COc1cc(NCC#N)c(OC)cc1Cl |
| InChI | InChI=1S/C10H11ClN2O2/c1-14-9-6-8(13-4-3-12)10(15-2)5-7(9)11/h5-6,13H,4H2,1-2H3 |
| InChIKey | QFAARKXYDXOZFP-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 54.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.66 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|