C13H16ClN3O3 — CID 28572795
2-(4-chloro-2,5-dimethoxyanilino)-N-(2-cyanoethyl)acetamide (PubChem CID 28572795) has the molecular formula C13H16ClN3O3 and a molecular weight of 297.74 g/mol. Its IUPAC name is 2-(4-chloro-2,5-dimethoxyanilino)-N-(2-cyanoethyl)acetamide.
| Compound Name | 2-(4-chloro-2,5-dimethoxyanilino)-N-(2-cyanoethyl)acetamide |
|---|---|
| PubChem CID | 28572795 |
| Molecular Formula | C13H16ClN3O3 |
| Molecular Weight | 297.74 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | 2-(4-chloro-2,5-dimethoxyanilino)-N-(2-cyanoethyl)acetamide |
| SMILES | COc1cc(NCC(=O)NCCC#N)c(OC)cc1Cl |
| InChI | InChI=1S/C13H16ClN3O3/c1-19-11-7-10(12(20-2)6-9(11)14)17-8-13(18)16-5-3-4-15/h6-7,17H,3,5,8H2,1-2H3,(H,16,18) |
| InChIKey | LBGKUZAMOMDZLQ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 83.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.74 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|