C13H17N3O — CID 28585854
N-(2-cyanoethyl)-2-(2,5-dimethylanilino)acetamide (PubChem CID 28585854) has the molecular formula C13H17N3O and a molecular weight of 231.30 g/mol. Its IUPAC name is N-(2-cyanoethyl)-2-(2,5-dimethylanilino)acetamide.
| Compound Name | N-(2-cyanoethyl)-2-(2,5-dimethylanilino)acetamide |
|---|---|
| PubChem CID | 28585854 |
| Molecular Formula | C13H17N3O |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.14 |
| IUPAC Name | N-(2-cyanoethyl)-2-(2,5-dimethylanilino)acetamide |
| SMILES | Cc1ccc(C)c(NCC(=O)NCCC#N)c1 |
| InChI | InChI=1S/C13H17N3O/c1-10-4-5-11(2)12(8-10)16-9-13(17)15-7-3-6-14/h4-5,8,16H,3,7,9H2,1-2H3,(H,15,17) |
| InChIKey | VRXPWNJXQUTLMI-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|