C14H22N2O2 — CID 39353588
2-(2,5-dimethylanilino)-N-(3-methoxypropyl)acetamide (PubChem CID 39353588) has the molecular formula C14H22N2O2 and a molecular weight of 250.34 g/mol. Its IUPAC name is 2-(2,5-dimethylanilino)-N-(3-methoxypropyl)acetamide.
| Compound Name | 2-(2,5-dimethylanilino)-N-(3-methoxypropyl)acetamide |
|---|---|
| PubChem CID | 39353588 |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | 2-(2,5-dimethylanilino)-N-(3-methoxypropyl)acetamide |
| SMILES | COCCCNC(=O)CNc1cc(C)ccc1C |
| InChI | InChI=1S/C14H22N2O2/c1-11-5-6-12(2)13(9-11)16-10-14(17)15-7-4-8-18-3/h5-6,9,16H,4,7-8,10H2,1-3H3,(H,15,17) |
| InChIKey | GQDVMFOCSQEJFZ-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|