C15H24N2O2 — CID 54811773
N-(3-methoxypropyl)-2-(2,4,6-trimethylanilino)acetamide (PubChem CID 54811773) has the molecular formula C15H24N2O2 and a molecular weight of 264.37 g/mol. Its IUPAC name is N-(3-methoxypropyl)-2-(2,4,6-trimethylanilino)acetamide.
| Compound Name | N-(3-methoxypropyl)-2-(2,4,6-trimethylanilino)acetamide |
|---|---|
| PubChem CID | 54811773 |
| Molecular Formula | C15H24N2O2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.18 |
| IUPAC Name | N-(3-methoxypropyl)-2-(2,4,6-trimethylanilino)acetamide |
| SMILES | COCCCNC(=O)CNc1c(C)cc(C)cc1C |
| InChI | InChI=1S/C15H24N2O2/c1-11-8-12(2)15(13(3)9-11)17-10-14(18)16-6-5-7-19-4/h8-9,17H,5-7,10H2,1-4H3,(H,16,18) |
| InChIKey | DELHEPYHJZKUPV-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|