C19H24N2O2 — CID 54812010
N-[(4-methoxyphenyl)methyl]-2-(2,4,6-trimethylanilino)acetamide (PubChem CID 54812010) has the molecular formula C19H24N2O2 and a molecular weight of 312.41 g/mol. Its IUPAC name is N-[(4-methoxyphenyl)methyl]-2-(2,4,6-trimethylanilino)acetamide.
| Compound Name | N-[(4-methoxyphenyl)methyl]-2-(2,4,6-trimethylanilino)acetamide |
|---|---|
| PubChem CID | 54812010 |
| Molecular Formula | C19H24N2O2 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | N-[(4-methoxyphenyl)methyl]-2-(2,4,6-trimethylanilino)acetamide |
| SMILES | COc1ccc(CNC(=O)CNc2c(C)cc(C)cc2C)cc1 |
| InChI | InChI=1S/C19H24N2O2/c1-13-9-14(2)19(15(3)10-13)21-12-18(22)20-11-16-5-7-17(23-4)8-6-16/h5-10,21H,11-12H2,1-4H3,(H,20,22) |
| InChIKey | FHHJRSQDQVYSTA-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |