C12H15Cl3N2O2 — CID 61486510
N-(3-methoxypropyl)-2-(2,4,6-trichloroanilino)acetamide (PubChem CID 61486510) has the molecular formula C12H15Cl3N2O2 and a molecular weight of 325.62 g/mol. Its IUPAC name is N-(3-methoxypropyl)-2-(2,4,6-trichloroanilino)acetamide.
| Compound Name | N-(3-methoxypropyl)-2-(2,4,6-trichloroanilino)acetamide |
|---|---|
| PubChem CID | 61486510 |
| Molecular Formula | C12H15Cl3N2O2 |
| Molecular Weight | 325.62 g/mol |
| Exact Mass | 324.02 |
| IUPAC Name | N-(3-methoxypropyl)-2-(2,4,6-trichloroanilino)acetamide |
| SMILES | COCCCNC(=O)CNc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C12H15Cl3N2O2/c1-19-4-2-3-16-11(18)7-17-12-9(14)5-8(13)6-10(12)15/h5-6,17H,2-4,7H2,1H3,(H,16,18) |
| InChIKey | GTHMIUXLEWGIID-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.62 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|