C13H19ClN2O3 — CID 54819347
2-(3-chloro-4-methoxyanilino)-N-(3-methoxypropyl)acetamide (PubChem CID 54819347) has the molecular formula C13H19ClN2O3 and a molecular weight of 286.76 g/mol. Its IUPAC name is 2-(3-chloro-4-methoxyanilino)-N-(3-methoxypropyl)acetamide.
| Compound Name | 2-(3-chloro-4-methoxyanilino)-N-(3-methoxypropyl)acetamide |
|---|---|
| PubChem CID | 54819347 |
| Molecular Formula | C13H19ClN2O3 |
| Molecular Weight | 286.76 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | 2-(3-chloro-4-methoxyanilino)-N-(3-methoxypropyl)acetamide |
| SMILES | COCCCNC(=O)CNc1ccc(OC)c(Cl)c1 |
| InChI | InChI=1S/C13H19ClN2O3/c1-18-7-3-6-15-13(17)9-16-10-4-5-12(19-2)11(14)8-10/h4-5,8,16H,3,6-7,9H2,1-2H3,(H,15,17) |
| InChIKey | OEMAZUFZRQIDTO-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.76 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|