About 3-(3,5-dichlorophenyl)-3-hydroxy-N-(3-methoxypropyl)propanamide
3-(3,5-dichlorophenyl)-3-hydroxy-N-(3-methoxypropyl)propanamide (PubChem CID 111664681) has the molecular formula C13H17Cl2NO3
and a molecular weight of 306.19 g/mol. Its IUPAC name is 3-(3,5-dichlorophenyl)-3-hydroxy-N-(3-methoxypropyl)propanamide.
Molecular Properties
| Compound Name | 3-(3,5-dichlorophenyl)-3-hydroxy-N-(3-methoxypropyl)propanamide |
| PubChem CID | 111664681 |
| Molecular Formula | C13H17Cl2NO3 |
| Molecular Weight | 306.19 g/mol |
| Exact Mass | 305.06 |
| IUPAC Name | 3-(3,5-dichlorophenyl)-3-hydroxy-N-(3-methoxypropyl)propanamide |
| SMILES | COCCCNC(=O)CC(O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C13H17Cl2NO3/c1-19-4-2-3-16-13(18)8-12(17)9-5-10(14)7-11(15)6-9/h5-7,12,17H,2-4,8H2,1H3,(H,16,18) |
| InChIKey | GCCPJHKAEWUXTB-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.19 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(3,5-dichlorophenyl)-3-hydroxy-N-(3-methoxypropyl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,5-dichlorophenyl)-3-hydroxy-N-(3-methoxypropyl)propanamide?
The IUPAC name of 3-(3,5-dichlorophenyl)-3-hydroxy-N-(3-methoxypropyl)propanamide (CID 111664681) is 3-(3,5-dichlorophenyl)-3-hydroxy-N-(3-methoxypropyl)propanamide.
What is the SMILES notation for 3-(3,5-dichlorophenyl)-3-hydroxy-N-(3-methoxypropyl)propanamide?
The canonical SMILES for 3-(3,5-dichlorophenyl)-3-hydroxy-N-(3-methoxypropyl)propanamide is COCCCNC(=O)CC(O)c1cc(Cl)cc(Cl)c1.
What is the InChIKey of 3-(3,5-dichlorophenyl)-3-hydroxy-N-(3-methoxypropyl)propanamide?
The InChIKey is GCCPJHKAEWUXTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17Cl2NO3/c1-19-4-2-3-16-13(18)8-12(17)9-5-10(14)7-11(15)6-9/h5-7,12,17H,2-4,8H2,1H3,(H,16,18).
What are the key properties of 3-(3,5-dichlorophenyl)-3-hydroxy-N-(3-methoxypropyl)propanamide?
3-(3,5-dichlorophenyl)-3-hydroxy-N-(3-methoxypropyl)propanamide has a molecular weight of 306.19 g/mol, XLogP of 2.57, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,5-dichlorophenyl)-3-hydroxy-N-(3-methoxypropyl)propanamide is sourced from PubChem (CID 111664681), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).