C14H16Cl2N4O2S — CID 102558923
3-(3,5-dichlorophenyl)-3-hydroxy-N-[2-(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethyl]propanamide (PubChem CID 102558923) has the molecular formula C14H16Cl2N4O2S and a molecular weight of 375.28 g/mol. Its IUPAC name is 3-(3,5-dichlorophenyl)-3-hydroxy-N-[2-(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethyl]propanamide.
| Compound Name | 3-(3,5-dichlorophenyl)-3-hydroxy-N-[2-(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethyl]propanamide |
|---|---|
| PubChem CID | 102558923 |
| Molecular Formula | C14H16Cl2N4O2S |
| Molecular Weight | 375.28 g/mol |
| Exact Mass | 374.04 |
| IUPAC Name | 3-(3,5-dichlorophenyl)-3-hydroxy-N-[2-(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethyl]propanamide |
| SMILES | Cn1c(CCNC(=O)CC(O)c2cc(Cl)cc(Cl)c2)n[nH]c1=S |
| InChI | InChI=1S/C14H16Cl2N4O2S/c1-20-12(18-19-14(20)23)2-3-17-13(22)7-11(21)8-4-9(15)6-10(16)5-8/h4-6,11,21H,2-3,7H2,1H3,(H,17,22)(H,19,23) |
| InChIKey | UTHWXVFMJTWIMJ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 82.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.28 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|