C14H17F2N5O3S2 — CID 56578329
3-[(3,4-difluorophenyl)sulfonylamino]-N-[2-(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethyl]propanamide (PubChem CID 56578329) has the molecular formula C14H17F2N5O3S2 and a molecular weight of 405.45 g/mol. Its IUPAC name is 3-[(3,4-difluorophenyl)sulfonylamino]-N-[2-(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethyl]propanamide.
| Compound Name | 3-[(3,4-difluorophenyl)sulfonylamino]-N-[2-(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethyl]propanamide |
|---|---|
| PubChem CID | 56578329 |
| Molecular Formula | C14H17F2N5O3S2 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.07 |
| IUPAC Name | 3-[(3,4-difluorophenyl)sulfonylamino]-N-[2-(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethyl]propanamide |
| SMILES | Cn1c(CCNC(=O)CCNS(=O)(=O)c2ccc(F)c(F)c2)n[nH]c1=S |
| InChI | InChI=1S/C14H17F2N5O3S2/c1-21-12(19-20-14(21)25)4-6-17-13(22)5-7-18-26(23,24)9-2-3-10(15)11(16)8-9/h2-3,8,18H,4-7H2,1H3,(H,17,22)(H,20,25) |
| InChIKey | PAVPOCXCJJWXFS-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 108.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|