C17H18F2N2O3S2 — CID 24549470
3-[(3,4-difluorophenyl)sulfonylamino]-N-(2-phenylsulfanylethyl)propanamide (PubChem CID 24549470) has the molecular formula C17H18F2N2O3S2 and a molecular weight of 400.47 g/mol. Its IUPAC name is 3-[(3,4-difluorophenyl)sulfonylamino]-N-(2-phenylsulfanylethyl)propanamide.
| Compound Name | 3-[(3,4-difluorophenyl)sulfonylamino]-N-(2-phenylsulfanylethyl)propanamide |
|---|---|
| PubChem CID | 24549470 |
| Molecular Formula | C17H18F2N2O3S2 |
| Molecular Weight | 400.47 g/mol |
| Exact Mass | 400.07 |
| IUPAC Name | 3-[(3,4-difluorophenyl)sulfonylamino]-N-(2-phenylsulfanylethyl)propanamide |
| SMILES | O=C(CCNS(=O)(=O)c1ccc(F)c(F)c1)NCCSc1ccccc1 |
| InChI | InChI=1S/C17H18F2N2O3S2/c18-15-7-6-14(12-16(15)19)26(23,24)21-9-8-17(22)20-10-11-25-13-4-2-1-3-5-13/h1-7,12,21H,8-11H2,(H,20,22) |
| InChIKey | GPYXYWGWHSWRFN-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.47 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|