C22H23FN2O3S2 — CID 26635601
N-[3-(4-fluorophenyl)sulfanylpropyl]-3-(naphthalen-2-ylsulfonylamino)propanamide (PubChem CID 26635601) has the molecular formula C22H23FN2O3S2 and a molecular weight of 446.57 g/mol. Its IUPAC name is N-[3-(4-fluorophenyl)sulfanylpropyl]-3-(naphthalen-2-ylsulfonylamino)propanamide.
| Compound Name | N-[3-(4-fluorophenyl)sulfanylpropyl]-3-(naphthalen-2-ylsulfonylamino)propanamide |
|---|---|
| PubChem CID | 26635601 |
| Molecular Formula | C22H23FN2O3S2 |
| Molecular Weight | 446.57 g/mol |
| Exact Mass | 446.11 |
| IUPAC Name | N-[3-(4-fluorophenyl)sulfanylpropyl]-3-(naphthalen-2-ylsulfonylamino)propanamide |
| SMILES | O=C(CCNS(=O)(=O)c1ccc2ccccc2c1)NCCCSc1ccc(F)cc1 |
| InChI | InChI=1S/C22H23FN2O3S2/c23-19-7-9-20(10-8-19)29-15-3-13-24-22(26)12-14-25-30(27,28)21-11-6-17-4-1-2-5-18(17)16-21/h1-2,4-11,16,25H,3,12-15H2,(H,24,26) |
| InChIKey | FRGXTYXYKQHDLB-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.57 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|