C19H21N5O3S — CID 55647229
3-(naphthalen-2-ylsulfonylamino)-N-[2-(pyrimidin-2-ylamino)ethyl]propanamide (PubChem CID 55647229) has the molecular formula C19H21N5O3S and a molecular weight of 399.48 g/mol. Its IUPAC name is 3-(naphthalen-2-ylsulfonylamino)-N-[2-(pyrimidin-2-ylamino)ethyl]propanamide.
| Compound Name | 3-(naphthalen-2-ylsulfonylamino)-N-[2-(pyrimidin-2-ylamino)ethyl]propanamide |
|---|---|
| PubChem CID | 55647229 |
| Molecular Formula | C19H21N5O3S |
| Molecular Weight | 399.48 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | 3-(naphthalen-2-ylsulfonylamino)-N-[2-(pyrimidin-2-ylamino)ethyl]propanamide |
| SMILES | O=C(CCNS(=O)(=O)c1ccc2ccccc2c1)NCCNc1ncccn1 |
| InChI | InChI=1S/C19H21N5O3S/c25-18(20-12-13-23-19-21-9-3-10-22-19)8-11-24-28(26,27)17-7-6-15-4-1-2-5-16(15)14-17/h1-7,9-10,14,24H,8,11-13H2,(H,20,25)(H,21,22,23) |
| InChIKey | MQWWQVISCWXAHA-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 113.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.48 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|